| Product Name | 5-Iodoisatin |
| CAS No. | 20780-76-1 |
| Synonyms | 5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| InChI | InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| Molecular Formula | C8H4INO2 |
| Molecular Weight | 273.0273 |
| Density | 2.106g/cm3 |
| Melting point | 276-278℃ |
| Refractive index | 1.704 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20780-76-1 5-iodoisatin
service@apichina.com