| Product Name | 5-hydroxydodecanoic acid, monoester with glycerol |
| CAS No. | 26446-32-2 |
| Synonyms | 5-Hydroxydodecanoic acid, monoester with glycerol; 1,2,3-Propanetriol mono(5-hydroxydodecanoate); Dodecanoic acid, 5-hydroxy-, monoester with 1,2,3-propanetriol; Dodecanoic acid, 5-hydroxy-, monoester with glycerol; FEMA No. 3686; Glycerol, mono(5-hydroxydodecanoate); Glyceryl mono(5-hydroxydodecanoate); Glycerol 5-hydroxydodecanoate; 2,3-dihydroxypropyl 5-hydroxydodecanoate |
| InChI | InChI=1/C15H30O5/c1-2-3-4-5-6-8-13(18)9-7-10-15(19)20-14(11-16)12-17/h13-14,16-18H,2-12H2,1H3 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.3957 |
| Refractive index | 1.482 |
26446-32-2 5-hydroxydodecanoic acid, monoester with glycerol
service@apichina.com