| Product Name | 5-hydroxydecanoic acid, monoester with glycerol |
| CAS No. | 26446-31-1 |
| Synonyms | Decanoic acid, 5-hydroxy-, monoester with 1,2,3-propanetriol; 1,2,3-Propanetriol mono(5-hydroxydecanoate); Decanoic acid, 5-hydroxy-, monoester with glycerol; FEMA No. 3685; Glycerol mono(5-hydroxydecanoate); Glycerol, mono(5-hydroxydecanoate); Glyceryl 5-hydroxydecanoate; Glyceryl mono(5-hydroxydecanoate); Glyeryl 5-hydroxydecanoate; 5-Hydroxydecanoic acid, monoester with glycerol; Glycerol 5-hydroxydecanoate; 2,3-dihydroxypropyl 5-hydroxydecanoate |
| InChI | InChI=1/C13H26O5/c1-2-3-4-6-11(15)7-5-8-13(17)18-10-12(16)9-14/h11-12,14-16H,2-10H2,1H3 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.3425 |
| Density | 1.093g/cm3 |
| Boiling point | 413.4°C at 760 mmHg |
| Flash point | 148.1°C |
| Refractive index | 1.483 |
26446-31-1 5-hydroxydecanoic acid, monoester with glycerol
service@apichina.com