| Product Name | 5-Hexynoic acid |
| CAS No. | 53293-00-8 |
| Synonyms | Hex-5-ynoic acid; hex-5-ynoate |
| InChI | InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
| Molecular Formula | C6H7O2 |
| Molecular Weight | 111.1191 |
| Boiling point | 220.6°C at 760 mmHg |
| Flash point | 99.6°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
53293-00-8 5-hexynoic acid
service@apichina.com