| Product Name | 5-Hexenoic acid |
| CAS No. | 1577-22-6 |
| Synonyms | hex-5-enoic acid |
| InChI | InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.1424 |
| Density | 0.973g/cm3 |
| Boiling point | 202.6°C at 760 mmHg |
| Flash point | 100.1°C |
| Refractive index | 1.443 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1577-22-6 5-hexenoic acid
service@apichina.com