| Product Name | 5-hex-1-ynylpyridine-3-carbohydrazide |
| CAS No. | 306935-32-0 |
| Synonyms | 5-hex-1-yn-1-ylpyridine-3-carbohydrazide |
| InChI | InChI=1/C12H15N3O/c1-2-3-4-5-6-10-7-11(9-14-8-10)12(16)15-13/h7-9H,2-4,13H2,1H3,(H,15,16) |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.267 |
| Density | 1.14g/cm3 |
| Melting point | 158℃ |
| Refractive index | 1.572 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-32-0 5-hex-1-ynylpyridine-3-carbohydrazide
service@apichina.com