| Product Name | 5-fluoroindole-3-carboxaldehyde |
| CAS No. | 2338-71-8 |
| Synonyms | 5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
| InChI | InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.1484 |
| Density | 1.385g/cm3 |
| Boiling point | 342.4°C at 760 mmHg |
| Flash point | 160.9°C |
| Refractive index | 1.695 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2338-71-8 5-fluoroindole-3-carboxaldehyde
service@apichina.com