| Product Name | 5-Fluoro-2-methylphenylhydrazine hydrochloride |
| CAS No. | 325-50-8 |
| Synonyms | (5-fluoro-2-methylphenyl)diazanium chloride; (5-fluoro-2-methylphenyl)hydrazine |
| InChI | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.1582 |
| Density | 1.202g/cm3 |
| Boiling point | 212°C at 760 mmHg |
| Flash point | 82°C |
| Refractive index | 1.594 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
325-50-8 5-fluoro-2-methylphenylhydrazine hydrochloride
service@apichina.com