| Product Name | 5-fluoro-2-methylphenylboronic acid |
| CAS No. | 163517-62-2 |
| Synonyms | 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
| InChI | InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
| Molecular Formula | C7H8BFO2 |
| Molecular Weight | 153.9466 |
| Density | 1.2g/cm3 |
| Boiling point | 287.7°C at 760 mmHg |
| Flash point | 127.8°C |
| Refractive index | 1.505 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
163517-62-2 5-fluoro-2-methylphenylboronic acid
service@apichina.com