| Product Name | 5-Fluoro-2-methylbenzamide |
| CAS No. | 175278-28-1 |
| InChI | InChI=1/C8H8FNO/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H2,10,11) |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.1536 |
| Density | 1.19g/cm3 |
| Melting point | 120℃ |
| Boiling point | 214.6°C at 760 mmHg |
| Flash point | 83.6°C |
| Refractive index | 1.534 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-28-1 5-fluoro-2-methylbenzamide
service@apichina.com