| Product Name | 5-Fluoro-2-iodoaniline |
| CAS No. | 255724-71-1 |
| InChI | InChI=1/C6H5FIN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| Molecular Formula | C6H5FIN |
| Molecular Weight | 237.0135 |
| Density | 2.008g/cm3 |
| Boiling point | 258.2°C at 760 mmHg |
| Flash point | 110°C |
| Refractive index | 1.656 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
255724-71-1 5-fluoro-2-iodoaniline
service@apichina.com