| Product Name | 5-fluoro-2-(1H-imidazol-1-yl)aniline |
| CAS No. | 251649-52-2 |
| InChI | InChI=1/C9H8FN3/c10-7-1-2-9(8(11)5-7)13-4-3-12-6-13/h1-6H,11H2 |
| Molecular Formula | C9H8FN3 |
| Molecular Weight | 177.1783 |
| Density | 1.3g/cm3 |
| Melting point | 126℃ |
| Boiling point | 343.5°C at 760 mmHg |
| Flash point | 161.5°C |
| Refractive index | 1.621 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
251649-52-2 5-fluoro-2-(1h-imidazol-1-yl)aniline
service@apichina.com