| Product Name | 5-Ethylpyridine-2,3-dicarboxylic acid |
| CAS No. | 102268-15-5 |
| Synonyms | 5-Ethylquinolinic acid; 5-ethyl-2,3-pyridinedicarboxylic acid; Imazethapyr intermediate |
| InChI | InChI=1/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14) |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.1721 |
| Density | 1.388g/cm3 |
| Boiling point | 421.2°C at 760 mmHg |
| Flash point | 208.5°C |
| Refractive index | 1.595 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
102268-15-5 5-ethylpyridine-2,3-dicarboxylic acid
service@apichina.com