| Product Name | 5-Ethylidene-2-norbornene, mixt. of endo-and exo-isomers |
| CAS No. | 16219-75-3 |
| Synonyms | 5-ethylidene-8,9,10-trinorborn-2-ene; 5-ethylidenebicyclo(2.2.1)hept-2-ene; (5E)-5-ethylidenebicyclo[2.2.1]hept-2-ene; Ethylidene Norbornene |
| InChI | InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-4,7,9H,5-6H2,1H3/b8-2+ |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.1916 |
| Density | 1.038g/cm3 |
| Boiling point | 146°C at 760 mmHg |
| Flash point | 34.2°C |
| Refractive index | 1.623 |
| Risk Codes | R10:Flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
16219-75-3 5-ethylidene-2-norbornene, mixt. of endo-and exo-isomers
service@apichina.com