| Product Name | 5-ETHYL-2-PYRIDYLETHANOL |
| CAS No. | 5223-06-3 |
| Synonyms | 5-Ethyl-2-(2-hydroxyethyl)pyridine; 2-(5-ethyl-2-pyridinyl)-1-ethanol; 2-(5-Ethyl-2-pyridyl)ethanol; 2-(5-ethyl pyridin-2-yl)ethanol; 2-(5-Ethyl-2-pyridinyl)ethanol; 5-Ethyl-2-pyridineethanol |
| InChI | InChI=1/C9H13NO/c1-2-8-3-4-9(5-6-11)10-7-8/h3-4,7,11H,2,5-6H2,1H3 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 |
| Boiling point | 127℃ (5 mmHg) |
| Risk Codes | R21:Harmful in contact with skin.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
5223-06-3 5-ethyl-2-pyridylethanol
service@apichina.com