| Product Name | 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
| CAS No. | 81074-81-9 |
| Synonyms | 5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
| InChI | InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.6553 |
| Melting point | 122-125℃ |
| Boiling point | 217.7°C at 760 mmHg |
| Flash point | 85.5°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
service@apichina.com