| Product Name | 5-Chlorovanillic acid |
| CAS No. | 62936-23-6 |
| Synonyms | 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
| InChI | InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
| Molecular Formula | C8H7ClO4 |
| Molecular Weight | 202.5918 |
| Density | 1.485g/cm3 |
| Melting point | 241-243℃ |
| Boiling point | 352.3°C at 760 mmHg |
| Flash point | 166.9°C |
| Refractive index | 1.599 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
62936-23-6 5-chlorovanillic acid
service@apichina.com