| Product Name | 5-Chlorothianaphthene-3-acetonitrile |
| CAS No. | 23799-60-2 |
| Synonyms | 5-Chlorobenzo[b]thiophene-3-acetonitrile; (5-chloro-1-benzothiophen-3-yl)acetonitrile |
| InChI | InChI=1/C10H6ClNS/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6H,3H2 |
| Molecular Formula | C10H6ClNS |
| Molecular Weight | 207.6793 |
| Density | 1.373g/cm3 |
| Melting point | 133-135℃ |
| Boiling point | 373.5°C at 760 mmHg |
| Flash point | 179.7°C |
| Refractive index | 1.675 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23799-60-2 5-chlorothianaphthene-3-acetonitrile
service@apichina.com