| Product Name | 5-Chlorothianaphthene-3-acetic acid |
| CAS No. | 17266-30-7 |
| Synonyms | 5-Chlorobenzo[b]thiophene-3-acetic acid; (5-chloro-1-benzothiophen-3-yl)acetic acid |
| InChI | InChI=1/C10H7ClO2S/c11-7-1-2-9-8(4-7)6(5-14-9)3-10(12)13/h1-2,4-5H,3H2,(H,12,13) |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.6794 |
| Density | 1.487g/cm3 |
| Melting point | 148℃ |
| Boiling point | 410.6°C at 760 mmHg |
| Flash point | 202.1°C |
| Refractive index | 1.693 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17266-30-7 5-chlorothianaphthene-3-acetic acid
service@apichina.com