| Product Name | 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole |
| CAS No. | 57238-76-3 |
| Synonyms | 5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChI | InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.6437 |
| Density | 1.278g/cm3 |
| Melting point | 51℃ |
| Boiling point | 354.9°C at 760 mmHg |
| Flash point | 168.4°C |
| Refractive index | 1.547 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
57238-76-3 5-(chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole
service@apichina.com