| Product Name | 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole |
| CAS No. | 63417-81-2 |
| Synonyms | 5-(chloromethyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| InChI | InChI=1/C7H5ClN2OS/c8-4-6-9-7(10-11-6)5-2-1-3-12-5/h1-3H,4H2 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.6454 |
| Density | 1.421g/cm3 |
| Melting point | 59℃ |
| Boiling point | 331.3°C at 760 mmHg |
| Flash point | 154.1°C |
| Refractive index | 1.587 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
service@apichina.com