| Product Name | 5-Chloroindole |
| CAS No. | 17422-32-1 |
| Synonyms | 1H-Indole,5-chloro-(9CI); ; 5-chloro-1H-indole |
| InChI | InChI=1/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| Molecular Formula | C8H6ClN |
| Molecular Weight | 151.5929 |
| Density | 1.331g/cm3 |
| Melting point | 69-71℃ |
| Boiling point | 293°C at 760 mmHg |
| Flash point | 158.9°C |
| Refractive index | 1.688 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
17422-32-1 5-chloroindole
service@apichina.com