| Product Name | 5-chloro-N,2-dihydroxybenzamide |
| CAS No. | 37551-43-2 |
| Synonyms | 5-Chloro-N,2-dihydrobenzamide |
| InChI | InChI=1/C7H6ClNO3/c8-4-1-2-6(10)5(3-4)7(11)9-12/h1-3,10,12H,(H,9,11) |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.5804 |
| Density | 1.548g/cm3 |
| Melting point | 208℃ |
| Refractive index | 1.638 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
37551-43-2 5-chloro-n,2-dihydroxybenzamide
service@apichina.com