| Product Name | 5-Chloro-m-phenylenediamine |
| CAS No. | 33786-89-9 |
| Synonyms | 5-Chloro-1,3-diaminobenzene; 5-chlorobenzene-1,3-diamine |
| InChI | InChI=1/C6H7ClN2/c7-4-1-5(8)3-6(9)2-4/h1-3H,8-9H2 |
| Molecular Formula | C6H7ClN2 |
| Molecular Weight | 142.5862 |
| Density | 1.345g/cm3 |
| Boiling point | 333.6°C at 760 mmHg |
| Flash point | 155.6°C |
| Refractive index | 1.67 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S22:Do not inhale dust.; S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
33786-89-9 5-chloro-m-phenylenediamine
service@apichina.com