| Product Name | 5-chloro-6-phenylpyridazin-3-ol |
| CAS No. | 51660-08-3 |
| Synonyms | 5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
| InChI | InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| Molecular Formula | C10H7ClN2O |
| Molecular Weight | 206.6284 |
| Density | 1.35g/cm3 |
| Melting point | 235℃ |
| Boiling point | 403.2°C at 760 mmHg |
| Flash point | 197.7°C |
| Refractive index | 1.641 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
51660-08-3 5-chloro-6-phenylpyridazin-3-ol
service@apichina.com