| Product Name | 5-chloro-6-methyl-2,1,3-benzothiadiazole |
| CAS No. | 50636-02-7 |
| InChI | InChI=1/C7H5ClN2S/c1-4-2-6-7(3-5(4)8)10-11-9-6/h2-3H,1H3 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.646 |
| Density | 1.445g/cm3 |
| Melting point | 85℃ |
| Boiling point | 266.9°C at 760 mmHg |
| Flash point | 115.2°C |
| Refractive index | 1.682 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50636-02-7 5-chloro-6-methyl-2,1,3-benzothiadiazole
service@apichina.com