| Product Name | 5-Chloro-6-fluorobenzo-2,1,3-thiadiazole |
| CAS No. | 175204-22-5 |
| Synonyms | 5-Chloro-6-fluoro-2,1,3-benzothiadiazole; 5-Chloro-6-fluorobenzo[2,1,3]thiadiazole |
| InChI | InChI=1/C6H2ClFN2S/c7-3-1-5-6(2-4(3)8)10-11-9-5/h1-2H |
| Molecular Formula | C6H2ClFN2S |
| Molecular Weight | 188.6099 |
| Density | 1.631g/cm3 |
| Melting point | 78℃ |
| Boiling point | 255°C at 760 mmHg |
| Flash point | 108°C |
| Refractive index | 1.677 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-22-5 5-chloro-6-fluorobenzo-2,1,3-thiadiazole
service@apichina.com