| Product Name | 5-chloro-4-nitro-2,1,3-benzothiadiazole |
| CAS No. | 2274-89-7 |
| Synonyms | 5-Chloro-4-(hydroxy(oxido)amino)-2,1,3-benzothiadiazole; NSC 202425 |
| InChI | InChI=1/C6H2ClN3O2S/c7-3-1-2-4-5(9-13-8-4)6(3)10(11)12/h1-2H |
| Molecular Formula | C6H2ClN3O2S |
| Molecular Weight | 215.617 |
| Density | 1.749g/cm3 |
| Melting point | 149℃ |
| Boiling point | 348.8°C at 760 mmHg |
| Flash point | 164.7°C |
| Refractive index | 1.747 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2274-89-7 5-chloro-4-nitro-2,1,3-benzothiadiazole
service@apichina.com