| Product Name | 5-chloro-4-(chloromethyl)-1,2,3-thiadiazole |
| CAS No. | 88127-85-9 |
| InChI | InChI=1/C3H2Cl2N2S/c4-1-2-3(5)8-7-6-2/h1H2 |
| Molecular Formula | C3H2Cl2N2S |
| Molecular Weight | 169.0324 |
| Density | 1.609g/cm3 |
| Boiling point | 249.5°C at 760 mmHg |
| Flash point | 104.7°C |
| Refractive index | 1.59 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
88127-85-9 5-chloro-4-(chloromethyl)-1,2,3-thiadiazole
service@apichina.com