| Product Name | 5-chloro-3-methylbenzo[b]thiophene |
| CAS No. | 19404-18-3 |
| Synonyms | 5-Chloro-3-methylthianaphthene; 5-chloro-3-methyl-1-benzothiophene |
| InChI | InChI=1/C9H7ClS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3 |
| Molecular Formula | C9H7ClS |
| Molecular Weight | 182.6699 |
| Density | 1.293g/cm3 |
| Melting point | 32℃ |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 163.1°C |
| Refractive index | 1.66 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
19404-18-3 5-chloro-3-methylbenzo[b]thiophene
service@apichina.com