| Product Name | 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
| CAS No. | 50451-84-8 |
| InChI | InChI=1/C10H7ClO2S/c1-5-7-4-6(11)2-3-8(7)14-9(5)10(12)13/h2-4H,1H3,(H,12,13) |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.6794 |
| Density | 1.474g/cm3 |
| Melting point | 298℃ |
| Boiling point | 411.7°C at 760 mmHg |
| Flash point | 202.8°C |
| Refractive index | 1.695 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50451-84-8 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid
service@apichina.com