| Product Name | 5-Chloro-2-nitrobenzamide |
| CAS No. | 40763-96-0 |
| InChI | InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.5792 |
| Density | 1.52g/cm3 |
| Melting point | 157-160℃ |
| Boiling point | 301.7°C at 760 mmHg |
| Flash point | 136.3°C |
| Refractive index | 1.624 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
40763-96-0 5-chloro-2-nitrobenzamide
service@apichina.com