| Product Name | 5-chloro-2-(methylthio)aniline |
| CAS No. | 16423-54-4 |
| Synonyms | 5-chloro-2-(methylsulfanyl)aniline |
| InChI | InChI=1/C7H8ClNS/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,9H2,1H3 |
| Molecular Formula | C7H8ClNS |
| Molecular Weight | 173.6631 |
| Density | 1.28g/cm3 |
| Boiling point | 276°C at 760 mmHg |
| Flash point | 120.7°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
16423-54-4 5-chloro-2-(methylthio)aniline
service@apichina.com