| Product Name | 5-Chloro-2-methoxyphenyl isothiocyanate |
| CAS No. | 63429-99-2 |
| Synonyms | 5-Chloro-2-methoxyisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methoxybenzene |
| InChI | InChI=1/C8H6ClNOS/c1-11-8-3-2-6(9)4-7(8)10-5-12/h2-4H,1H3 |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.6573 |
| Density | 1.23g/cm3 |
| Melting point | 56℃ |
| Boiling point | 323.6°C at 760 mmHg |
| Flash point | 149.5°C |
| Refractive index | 1.572 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
63429-99-2 5-chloro-2-methoxyphenyl isothiocyanate
service@apichina.com