| Product Name | 5-Chloro-2-methoxyphenyl isocyanate |
| CAS No. | 55440-54-5 |
| Synonyms | 4-chloro-2-isocyanato-1-methoxybenzene |
| InChI | InChI=1/C8H6ClNO2/c1-12-8-3-2-6(9)4-7(8)10-5-11/h2-4H,1H3 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.5917 |
| Density | 1.22g/cm3 |
| Boiling point | 271.7°C at 760 mmHg |
| Flash point | 118.1°C |
| Refractive index | 1.534 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
55440-54-5 5-chloro-2-methoxyphenyl isocyanate
service@apichina.com