| Product Name | 5-chloro-2-fluorophenyl isothiocyanate |
| CAS No. | 247170-25-8 |
| Synonyms | 4-chloro-1-fluoro-2-isothiocyanatobenzene |
| InChI | InChI=1/C7H3ClFNS/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| Molecular Formula | C7H3ClFNS |
| Molecular Weight | 187.6218 |
| Density | 1.31g/cm3 |
| Boiling point | 272.6°C at 760 mmHg |
| Flash point | 118.6°C |
| Refractive index | 1.576 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
247170-25-8 5-chloro-2-fluorophenyl isothiocyanate
service@apichina.com