| Product Name | 5-Chloro-2-fluorobenzyl bromide |
| CAS No. | 71916-91-1 |
| Synonyms | alpha-Bromo-3-chloro-6-fluorotoluene; 2-Fluoro-5-chlorobenzyl bromide; 2-(bromomethyl)-4-chloro-1-fluorobenzene |
| InChI | InChI=1/C7H5BrClF/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| Molecular Formula | C7H5BrClF |
| Molecular Weight | 223.47 |
| Density | 1.654g/cm3 |
| Boiling point | 226.7°C at 760 mmHg |
| Flash point | 90.9°C |
| Refractive index | 1.561 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
71916-91-1 5-chloro-2-fluorobenzyl bromide
service@apichina.com