| Product Name | 5-Chloro-2,4-dinitrotoluene |
| CAS No. | 51676-74-5 |
| Synonyms | 3-Chloro-4,6-dinitrotoluene; 1-chloro-5-methyl-2,4-dinitrobenzene |
| InChI | InChI=1/C7H5ClN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| Molecular Formula | C7H5ClN2O4 |
| Molecular Weight | 216.5786 |
| Density | 1.532g/cm3 |
| Boiling point | 334°C at 760 mmHg |
| Flash point | 155.8°C |
| Refractive index | 1.61 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
51676-74-5 5-chloro-2,4-dinitrotoluene
service@apichina.com