| Product Name | 5-Chloro-2,4-diisocyanatotoluene |
| CAS No. | 15166-26-4 |
| Synonyms | 1-Chloro-2,4-diisocyanato-5-methylbenzene; benzene, 1-chloro-2,4-diisocyanato-5-methyl- |
| InChI | InChI=1/C9H5ClN2O2/c1-6-2-7(10)9(12-5-14)3-8(6)11-4-13/h2-3H,1H3 |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.6012 |
| Density | 1.29g/cm3 |
| Boiling point | 310.2°C at 760 mmHg |
| Flash point | 122°C |
| Refractive index | 1.579 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15166-26-4 5-chloro-2,4-diisocyanatotoluene
service@apichina.com