| Product Name | 5-Chloro-2,3-dihydroxypyridine |
| CAS No. | 53233-89-9 |
| Synonyms | 5-Chloropyridine-2,3-diol; 5-chloro-3-hydroxypyridin-2(1H)-one |
| InChI | InChI=1/C5H4ClNO2/c6-3-1-4(8)5(9)7-2-3/h1-2,8H,(H,7,9) |
| Molecular Formula | C5H4ClNO2 |
| Molecular Weight | 145.5438 |
| Density | 1.56g/cm3 |
| Melting point | 295℃ |
| Boiling point | 297.6°C at 760 mmHg |
| Flash point | 133.8°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
53233-89-9 5-chloro-2,3-dihydroxypyridine
service@apichina.com