| Product Name | 5-Chloro-2,3-diaminopyridine |
| CAS No. | 25710-20-7 |
| Synonyms | 2,3-Diamino-5-chloropyridine; 5-chloropyridine-2,3-diamine; 2,3-diamino-5-chloropyridinium |
| InChI | InChI=1/C5H6ClN3/c6-3-1-4(7)5(8)9-2-3/h1-2H,7H2,(H2,8,9)/p+1 |
| Molecular Formula | C5H7ClN3 |
| Molecular Weight | 144.5816 |
| Boiling point | 338.9°C at 760 mmHg |
| Flash point | 158.7°C |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
25710-20-7 5-chloro-2,3-diaminopyridine
service@apichina.com