| Product Name | 5-chloro-1-benzothiophene-3-carbonitrile |
| CAS No. | 16296-79-0 |
| InChI | InChI=1/C9H4ClNS/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,5H |
| Molecular Formula | C9H4ClNS |
| Molecular Weight | 193.6528 |
| Density | 1.42g/cm3 |
| Melting point | 121℃ |
| Boiling point | 347.9°C at 760 mmHg |
| Flash point | 164.2°C |
| Refractive index | 1.69 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
16296-79-0 5-chloro-1-benzothiophene-3-carbonitrile
service@apichina.com