| Product Name | 5-Chloro-1,3-dimethyl-4-nitropyrazole |
| CAS No. | 13551-73-0 |
| Synonyms | 5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole |
| InChI | InChI=1/C5H6ClN3O2/c1-3-4(9(10)11)5(6)8(2)7-3/h1-2H3 |
| Molecular Formula | C5H6ClN3O2 |
| Molecular Weight | 175.573 |
| Density | 1.55g/cm3 |
| Melting point | 75℃ |
| Boiling point | 275.7°C at 760 mmHg |
| Flash point | 120.6°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13551-73-0 5-chloro-1,3-dimethyl-4-nitropyrazole
service@apichina.com