| Product Name | 5-chloro-1,3-dimethyl-4-(2-phenyldiaz-1-enyl)-1H-pyrazole |
| CAS No. | 78431-21-7 |
| Synonyms | 5-chloro-1,3-dimethyl-4-[(E)-phenyldiazenyl]-1H-pyrazole |
| InChI | InChI=1/C11H11ClN4/c1-8-10(11(12)16(2)15-8)14-13-9-6-4-3-5-7-9/h3-7H,1-2H3/b14-13+ |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.6848 |
| Density | 1.26g/cm3 |
| Melting point | 44℃ |
| Boiling point | 382.9°C at 760 mmHg |
| Flash point | 185.3°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
78431-21-7 5-chloro-1,3-dimethyl-4-(2-phenyldiaz-1-enyl)-1h-pyrazole
service@apichina.com