| Product Name | 5-chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid |
| CAS No. | 27006-82-2 |
| InChI | InChI=1/C6H7ClN2O2/c1-3-4(6(10)11)5(7)9(2)8-3/h1-2H3,(H,10,11) |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.585 |
| Density | 1.47g/cm3 |
| Melting point | 198℃ |
| Boiling point | 316.1°C at 760 mmHg |
| Flash point | 145°C |
| Refractive index | 1.603 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
27006-82-2 5-chloro-1,3-dimethyl-1h-pyrazole-4-carboxylic acid
service@apichina.com