| Product Name | 5-Chloro-1,2-dibromo-3-fluorobenzene |
| CAS No. | 208186-78-1 |
| Synonyms | 5-Chloro-2,3-dibromo-1-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene |
| InChI | InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
| Molecular Formula | C6H2Br2ClF |
| Molecular Weight | 288.3395 |
| Density | 2.089g/cm3 |
| Boiling point | 245.3°C at 760 mmHg |
| Flash point | 102.1°C |
| Refractive index | 1.589 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
208186-78-1 5-chloro-1,2-dibromo-3-fluorobenzene
service@apichina.com