| Product Name | 5-Bromotryptamine hydrochloride |
| CAS No. | 81868-12-4 |
| Synonyms | 2-(5-bromo-1H-indol-3-yl)ethanamine hydrochloride; 5-Bromotryptamine Hcl |
| InChI | InChI=1/C10H11BrN2.ClH/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10;/h1-2,5-6,13H,3-4,12H2;1H |
| Molecular Formula | C10H12BrClN2 |
| Molecular Weight | 275.5727 |
| Boiling point | 419.9°C at 760 mmHg |
| Flash point | 207.7°C |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
81868-12-4 5-bromotryptamine hydrochloride
service@apichina.com