| Product Name | 5-bromopyridine-3-carbohydrazide |
| CAS No. | 112193-41-6 |
| InChI | InChI=1/C6H6BrN3O/c7-5-1-4(2-9-3-5)6(11)10-8/h1-3H,8H2,(H,10,11) |
| Molecular Formula | C6H6BrN3O |
| Molecular Weight | 216.0353 |
| Density | 1.709g/cm3 |
| Melting point | 204℃ |
| Refractive index | 1.623 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
112193-41-6 5-bromopyridine-3-carbohydrazide
service@apichina.com