| Product Name | 5-Bromonicotinoyl chloride |
| CAS No. | 39620-02-5 |
| Synonyms | 5-Bromopyridine-3-carbonyl chloride |
| InChI | InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
| Molecular Formula | C6H3BrClNO |
| Molecular Weight | 220.4511 |
| Density | 1.76g/cm3 |
| Melting point | 75℃ |
| Boiling point | 265.4°C at 760 mmHg |
| Flash point | 114.3°C |
| Refractive index | 1.59 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
39620-02-5 5-bromonicotinoyl chloride
service@apichina.com