| Product Name | 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole |
| CAS No. | 65858-51-7 |
| InChI | InChI=1/C7H4BrClN2S/c8-3-4-1-6-7(2-5(4)9)11-12-10-6/h1-2H,3H2 |
| Molecular Formula | C7H4BrClN2S |
| Molecular Weight | 263.5421 |
| Density | 1.87g/cm3 |
| Melting point | 75℃ |
| Boiling point | 331.2°C at 760 mmHg |
| Flash point | 154.1°C |
| Refractive index | 1.729 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
65858-51-7 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole
service@apichina.com